Merge pull request #8 from okorpheus/invoicing

Invoicing Feature Complete

app/Http/Controllers/Admin/AuditionSettings.php

@@ -21,9 +21,15 @@ class AuditionSettings extends Controller
             'organizerName' => ['required'],
             'organizerEmail' => ['required', 'email'],
             'registrationCode' => ['required'],
-            'late_fee' => ['nullable', 'numeric'],
+            'fee_structure' => ['required', 'in:oneFeePerEntry,oneFeePerStudent'], // Options should align with the boot method of InvoiceDataServiceProvider
-            'school_fee' => ['nullable', 'numeric'],
+            'late_fee' => ['nullable', 'numeric', 'min:0'],
+            'school_fee' => ['nullable', 'numeric', 'min:0'],
         ]);
+
+        // Store currency values as cents
+        $validData['late_fee'] = $validData['late_fee'] * 100;
+        $validData['school_fee'] = $validData['school_fee'] * 100;
+
         // TODO implement olympic scoring
         foreach ($validData as $key => $value) {
             Settings::set($key, $value);

app/Http/Controllers/Admin/SchoolController.php

@@ -5,6 +5,7 @@ namespace App\Http\Controllers\Admin;
 use App\Http\Controllers\Controller;
 use App\Models\School;
 use App\Models\SchoolEmailDomain;
+use App\Services\Invoice\InvoiceDataService;
 use Illuminate\Http\Request;
 use Illuminate\Support\Facades\Auth;
 
@@ -14,14 +15,25 @@ use function request;
 
 class SchoolController extends Controller
 {
+    protected $invoiceService;
+
+    public function __construct(InvoiceDataService $invoiceController)
+    {
+        $this->invoiceService = $invoiceController;
+    }
+
     public function index()
     {
         if (! Auth::user()->is_admin) {
             abort(403);
         }
         $schools = School::with(['users', 'students', 'entries'])->orderBy('name')->get();
+        $schoolTotalFees = [];
+        foreach ($schools as $school) {
+            $schoolTotalFees[$school->id] = $this->invoiceService->getGrandTotal($school->id);
+        }
 
-        return view('admin.schools.index', ['schools' => $schools]);
+        return view('admin.schools.index', compact('schools', 'schoolTotalFees'));
     }
 
     public function show(Request $request, School $school)
@@ -122,4 +134,11 @@ class SchoolController extends Controller
         // return a redirect to the previous URL
         return redirect()->back();
     }
+
+    public function viewInvoice(Request $request, School $school)
+    {
+        $invoiceData = $this->invoiceService->allData($school->id);
+
+        return view('dashboard.invoice', compact('school', 'invoiceData'));
+    }
 }

app/Http/Controllers/DashboardController.php

@@ -2,13 +2,20 @@
 
 namespace App\Http\Controllers;
 
-use Illuminate\Http\Request;
+use App\Services\Invoice\InvoiceDataService;
 use Illuminate\Support\Facades\Auth;
-use function dd;
+
 use function redirect;
 
 class DashboardController extends Controller
 {
+    protected InvoiceDataService $invoiceService;
+
+    public function __construct(InvoiceDataService $invoiceService)
+    {
+        $this->invoiceService = $invoiceService;
+    }
+
     public function profile()
     {
         return view('dashboard.profile');
@@ -25,7 +32,20 @@ class DashboardController extends Controller
             return redirect('/schools/'.Auth::user()->school->id);
         }
         $possibilities = Auth::user()->possibleSchools();
-        if (count($possibilities) < 1) return view('schools.create');
+        if (count($possibilities) < 1) {
+            return view('schools.create');
+        }
+
         return view('dashboard.select_school', ['possibilities' => $possibilities]);
     }
+
+    public function my_invoice()
+    {
+        if (! Auth::user()->school_id) {
+            return redirect()->route('dashboard')->with('error', 'You do not have a school to get an invoice for');
+        }
+        $invoiceData = $this->invoiceService->allData(Auth::user()->school_id);
+        $school = Auth::user()->school;
+        return view('dashboard.invoice', compact('school', 'invoiceData'));
+    }
 }

app/Http/Controllers/ResultsPage.php

@@ -4,20 +4,20 @@ namespace App\Http\Controllers;
 
 use App\Models\Entry;
 use App\Models\Seat;
-use App\Services\AuditionCacheService;
+use App\Services\AuditionService;
 use App\Services\SeatingService;
 use Illuminate\Http\Request;
 use Illuminate\Support\Facades\Cache;
 
 class ResultsPage extends Controller
 {
-    protected $auditionCacheService;
+    protected $auditionService;
 
     protected $seatingService;
 
-    public function __construct(AuditionCacheService $auditionCacheService, SeatingService $seatingService)
+    public function __construct(AuditionService $auditionService, SeatingService $seatingService)
     {
-        $this->auditionCacheService = $auditionCacheService;
+        $this->auditionService = $auditionService;
         $this->seatingService  = $seatingService;
     }
 
@@ -26,7 +26,7 @@ class ResultsPage extends Controller
      */
     public function __invoke(Request $request)
     {
-        $publishedAuditions = $this->auditionCacheService->getPublishedAuditions();
+        $publishedAuditions = $this->auditionService->getPublishedAuditions();
         $resultsSeatList = Cache::rememberForever('resultsSeatList', function () use ($publishedAuditions) {
             $seatList = [];
             // Load the $seatList in the form of $seatlist[audition_id] is an array of seats for that audition
@@ -51,7 +51,7 @@ class ResultsPage extends Controller
             return $seatList;
         });
 
-        $publishedAdvancementAuditions = $this->auditionCacheService->getPublishedAdvancementAuditions();
+        $publishedAdvancementAuditions = $this->auditionService->getPublishedAdvancementAuditions();
         $resultsAdvancementList = Cache::rememberForever('resultsAdvancementList', function () use ($publishedAdvancementAuditions) {
             $qualifierList = [];
             foreach ($publishedAdvancementAuditions as $audition) {

app/Http/Controllers/Tabulation/DoublerDecisionController.php

@@ -6,14 +6,14 @@ use App\Http\Controllers\Controller;
 use App\Models\Entry;
 use App\Models\EntryFlag;
 use App\Services\DoublerService;
-use App\Services\EntryCacheService;
+use App\Services\EntryService;
 
 class DoublerDecisionController extends Controller
 {
     protected $doublerService;
     protected $entryService;
 
-    public function __construct(DoublerService $doublerService, EntryCacheService $entryService)
+    public function __construct(DoublerService $doublerService, EntryService $entryService)
     {
         $this->doublerService = $doublerService;
         $this->entryService = $entryService;

app/Http/Controllers/Tabulation/TabulationController.php

@@ -5,7 +5,7 @@ namespace App\Http\Controllers\Tabulation;
 use App\Http\Controllers\Controller;
 use App\Models\Audition;
 use App\Models\Seat;
-use App\Services\AuditionCacheService;
+use App\Services\AuditionService;
 use App\Services\DoublerService;
 use App\Services\SeatingService;
 use App\Services\TabulationService;
@@ -22,17 +22,17 @@ class TabulationController extends Controller
 
     protected $seatingService;
 
-    protected $auditionCacheService;
+    protected $auditionService;
 
     public function __construct(TabulationService $tabulationService,
         DoublerService $doublerService,
         SeatingService $seatingService,
-        AuditionCacheService $auditionCacheService)
+        AuditionService $auditionService)
     {
         $this->tabulationService = $tabulationService;
         $this->doublerService = $doublerService;
         $this->seatingService = $seatingService;
-        $this->auditionCacheService = $auditionCacheService;
+        $this->auditionService = $auditionService;
     }
 
     public function status()

app/Http/Controllers/TestController.php

@@ -2,7 +2,8 @@
 
 namespace App\Http\Controllers;
 
-use App\Services\AuditionCacheService;
+use App\Services\AuditionService;
+use App\Services\Invoice\InvoiceDataService;
 use App\Services\TabulationService;
 use Illuminate\Http\Request;
 use Illuminate\Support\Facades\Session;
@@ -11,16 +12,22 @@ class TestController extends Controller
 {
     protected $scoringGuideCacheService;
     protected $tabulationService;
+    protected $invoiceService;
 
-    public function __construct(AuditionCacheService $scoringGuideCacheService, TabulationService $tabulationService)
+    public function __construct(
-    {
+        AuditionService $scoringGuideCacheService,
+        TabulationService $tabulationService,
+        InvoiceDataService $invoiceService
+    ) {
         $this->scoringGuideCacheService = $scoringGuideCacheService;
         $this->tabulationService = $tabulationService;
+        $this->invoiceService = $invoiceService;
     }
 
     public function flashTest(Request $request)
     {
-        $auditions = $this->tabulationService->getAuditionsWithStatus();
+        $lines = $this->invoiceService->getLines(12);
-        return view('test', compact('auditions'));
+        $totalFees = $this->invoiceService->getGrandTotal(12);
+        return view('test', compact('lines','totalFees'));
     }
 }

app/Listeners/RefreshAuditionCache.php

@@ -3,19 +3,18 @@
 namespace App\Listeners;
 
 use App\Events\AuditionChange;
-use App\Services\AuditionCacheService;
+use App\Services\AuditionService;
-use Illuminate\Contracts\Queue\ShouldQueue;
-use Illuminate\Queue\InteractsWithQueue;
 
 class RefreshAuditionCache
 {
-    protected $auditionCacheService;
+    protected $auditionService;
+
     /**
      * Create the event listener.
      */
-    public function __construct(AuditionCacheService $cacheService)
+    public function __construct(AuditionService $cacheService)
     {
-        $this->auditionCacheService = $cacheService;
+        $this->auditionService = $cacheService;
     }
 
     /**
@@ -24,9 +23,9 @@ class RefreshAuditionCache
     public function handle(AuditionChange $event): void
     {
         if ($event->refreshCache) {
-            $this->auditionCacheService->refreshCache();
+            $this->auditionService->refreshCache();
         } else {
-            $this->auditionCacheService->clearCache();
+            $this->auditionService->clearCache();
         }
     }
 }

app/Listeners/RefreshEntryCache.php

@@ -4,20 +4,20 @@ namespace App\Listeners;
 
 use App\Events\AuditionChange;
 use App\Events\EntryChange;
-use App\Services\AuditionCacheService;
+use App\Services\AuditionService;
-use App\Services\EntryCacheService;
+use App\Services\EntryService;
 use Illuminate\Contracts\Queue\ShouldQueue;
 use Illuminate\Queue\InteractsWithQueue;
 
 class RefreshEntryCache
 {
-    protected $entryCacheService;
+    protected $entryService;
     /**
      * Create the event listener.
      */
-    public function __construct(EntryCacheService $cacheService)
+    public function __construct(EntryService $cacheService)
     {
-        $this->entryCacheService = $cacheService;
+        $this->entryService = $cacheService;
     }
 
     /**
@@ -26,9 +26,9 @@ class RefreshEntryCache
     public function handle(EntryChange $event): void
     {
         if ($event->auditionId) {
-            $this->entryCacheService->clearEntryCacheForAudition($event->auditionId);
+            $this->entryService->clearEntryCacheForAudition($event->auditionId);
         } else {
-            $this->entryCacheService->clearEntryCaches();
+            $this->entryService->clearEntryCaches();
         }
     }
 }

app/Models/School.php

@@ -17,10 +17,12 @@ class School extends Model
     {
         return $this->hasMany(User::class);
     }
+
     public function users(): HasMany
     {
         return $this->hasMany(User::class);
     }
+
     public function emailDomains(): HasMany
     {
         return $this->hasMany(SchoolEmailDomain::class);
@@ -30,12 +32,13 @@ class School extends Model
     {
         $img = "https://ui-avatars.com/api/?background=$bg_color&color=$text_color&name=";
         $img .= substr($this->name, 0, 1);
+
         return $img;
     }
 
     public function students(): HasMany
     {
-        return $this->hasMany(Student::class);
+        return $this->hasMany(Student::class)->orderBy('last_name')->orderBy('first_name');
     }
 
     public function entries(): HasManyThrough
@@ -48,5 +51,4 @@ class School extends Model
             'id',
             'id');
     }
-
 }

app/Providers/AppServiceProvider.php

@@ -34,9 +34,9 @@ use App\Observers\SeatingLimitObserver;
 use App\Observers\StudentObserver;
 use App\Observers\SubscoreDefinitionObserver;
 use App\Observers\UserObserver;
-use App\Services\AuditionCacheService;
+use App\Services\AuditionService;
 use App\Services\DoublerService;
-use App\Services\EntryCacheService;
+use App\Services\EntryService;
 use App\Services\ScoreService;
 use App\Services\SeatingService;
 use App\Services\TabulationService;
@@ -50,31 +50,31 @@ class AppServiceProvider extends ServiceProvider
      */
     public function register(): void
     {
-        $this->app->singleton(AuditionCacheService::class, function () {
+        $this->app->singleton(AuditionService::class, function () {
-            return new AuditionCacheService();
+            return new AuditionService();
         });
 
         $this->app->singleton(SeatingService::class, function ($app) {
             return new SeatingService($app->make(TabulationService::class));
         });
 
-        $this->app->singleton(EntryCacheService::class, function ($app) {
+        $this->app->singleton(EntryService::class, function ($app) {
-            return new EntryCacheService($app->make(AuditionCacheService::class));
+            return new EntryService($app->make(AuditionService::class));
         });
 
         $this->app->singleton(ScoreService::class, function ($app) {
-            return new ScoreService($app->make(AuditionCacheService::class), $app->make(EntryCacheService::class));
+            return new ScoreService($app->make(AuditionService::class), $app->make(EntryService::class));
         });
 
         $this->app->singleton(TabulationService::class, function ($app) {
             return new TabulationService(
-                $app->make(AuditionCacheService::class),
+                $app->make(AuditionService::class),
                 $app->make(ScoreService::class),
-                $app->make(EntryCacheService::class));
+                $app->make(EntryService::class));
         });
 
         $this->app->singleton(DoublerService::class, function ($app) {
-            return new DoublerService($app->make(AuditionCacheService::class), $app->make(TabulationService::class), $app->make(SeatingService::class));
+            return new DoublerService($app->make(AuditionService::class), $app->make(TabulationService::class), $app->make(SeatingService::class));
         });
     }
 

app/Providers/InvoiceDataServiceProvider.php

@@ -0,0 +1,38 @@
+<?php
+
+namespace App\Providers;
+
+use App\Services\EntryService;
+use App\Services\Invoice\InvoiceDataService;
+use App\Services\Invoice\InvoiceOneFeePerEntry;
+use App\Services\Invoice\InvoiceOneFeePerStudent;
+use Illuminate\Support\ServiceProvider;
+use function auditionSetting;
+
+class InvoiceDataServiceProvider extends ServiceProvider
+{
+    /**
+     * Register services.
+     */
+    public function register(): void
+    {
+        $this->app->singleton(InvoiceDataService::class, function ($app) {
+            // Default binding, can be overridden in booth method
+            return new InvoiceOneFeePerEntry($app->make(EntryService::class));
+        });
+    }
+
+    /**
+     * Bootstrap services.
+     */
+    public function boot(): void
+    {
+        $this->app->singleton(InvoiceDataService::class, function ($app) {
+            return match (auditionSetting('fee_structure')) {
+                'oneFeePerEntry' => new InvoiceOneFeePerEntry($app->make(EntryService::class)),
+                'oneFeePerStudent' => new InvoiceOneFeePerStudent($app->make(EntryService::class)),
+                default => throw new \Exception('Unknown Invoice Method'),
+            };
+        });
+    }
+}

app/Services/AuditionService.php

@@ -9,7 +9,7 @@ use Illuminate\Support\Facades\App;
 use Illuminate\Support\Facades\Cache;
 use Illuminate\Support\Facades\Session;
 
-class AuditionCacheService
+class AuditionService
 {
     protected $cacheKey = 'auditions';
 

app/Services/DoublerService.php

@@ -11,7 +11,7 @@ class DoublerService
 {
     protected $doublersCacheKey = 'doublers';
 
-    protected $auditionCacheService;
+    protected $auditionService;
 
     protected $tabulationService;
 
@@ -20,9 +20,9 @@ class DoublerService
     /**
      * Create a new class instance.
      */
-    public function __construct(AuditionCacheService $auditionCacheService, TabulationService $tabulationService, SeatingService $seatingService)
+    public function __construct(AuditionService $auditionService, TabulationService $tabulationService, SeatingService $seatingService)
     {
-        $this->auditionCacheService = $auditionCacheService;
+        $this->auditionService   = $auditionService;
         $this->tabulationService = $tabulationService;
         $this->seatingService = $seatingService;
     }
@@ -100,13 +100,13 @@ class DoublerService
             $info[$entry->id] = [
                 'entryID' => $entry->id,
                 'auditionID' => $entry->audition_id,
-                'auditionName' => $this->auditionCacheService->getAudition($entry->audition_id)->name,
+                'auditionName' => $this->auditionService->getAudition($entry->audition_id)->name,
                 'rank' => $this->tabulationService->entryRank($entry),
                 'unscored' => $this->tabulationService->remainingEntriesForAudition($entry->audition_id),
                 'limits' => $this->seatingService->getLimitForAudition($entry->audition_id),
                 'status' => $status,
             ];
-            $entry->audition = $this->auditionCacheService->getAudition($entry->audition_id);
+            $entry->audition = $this->auditionService->getAudition($entry->audition_id);
         }
 
         return $info;

app/Services/EntryService.php

@@ -6,14 +6,14 @@ use App\Models\Entry;
 use Illuminate\Support\Collection;
 use Illuminate\Support\Facades\Cache;
 
-class EntryCacheService
+class EntryService
 {
     protected $auditionCache;
 
     /**
      * Create a new class instance.
      */
-    public function __construct(AuditionCacheService $auditionCache)
+    public function __construct(AuditionService $auditionCache)
     {
         $this->auditionCache = $auditionCache;
     }
@@ -89,4 +89,13 @@ class EntryCacheService
             $this->clearEntryCacheForAudition($audition->id);
         }
     }
+
+    public function entryIsLate(Entry $entry): bool
+    {
+        if ($entry->hasFlag('wave_late_fee')) {
+            return false;
+        }
+
+        return $entry->created_at > $entry->audition->entry_deadline;
+    }
 }

app/Services/Invoice/InvoiceDataService.php

@@ -0,0 +1,18 @@
+<?php
+
+namespace App\Services\Invoice;
+
+interface InvoiceDataService
+{
+    public function allData($schoolId);
+
+    public function getLines($schoolId);
+
+    public function getLinesTotal($schoolId);
+
+    public function getLateFeesTotal($schoolId);
+
+    public function getSchoolFeeTotal($schoolId);
+
+    public function getGrandTotal($schoolId);
+}

app/Services/Invoice/InvoiceOneFeePerEntry.php

@@ -0,0 +1,93 @@
+<?php
+
+namespace App\Services\Invoice;
+
+use App\Models\School;
+use App\Services\EntryService;
+use Illuminate\Support\Arr;
+
+use function auditionSetting;
+
+class InvoiceOneFeePerEntry implements InvoiceDataService
+{
+    /**
+     * Create a new class instance.
+     */
+    protected $entryService;
+
+    public function __construct(EntryService $entryService)
+    {
+        $this->entryService = $entryService;
+    }
+
+    public function allData($schoolId)
+    {
+        static $schoolInvoiceData = [];
+
+        if (Arr::has($schoolInvoiceData, $schoolId)) {
+            return $schoolInvoiceData[$schoolId];
+        }
+        $school = School::findOrFail($schoolId);
+
+        $invoiceData['lines'] = [];
+        $invoiceData['linesTotal'] = 0;
+        $invoiceData['lateFeesTotal'] = 0;
+        /** @noinspection PhpArrayIndexImmediatelyRewrittenInspection */
+        $invoiceData['grandTotal'] = 0;
+
+        $entries = $school->entries()->with('audition')->orderBy('created_at', 'desc')->get()->groupBy('student_id');
+        foreach ($school->students as $student) {
+            foreach ($entries[$student->id] ?? [] as $entry) {
+                $entryFee = $entry->audition->entry_fee / 100;
+                $lateFee = $this->entryService->entryIsLate($entry) ? auditionSetting('late_fee') / 100 : 0;
+
+                $invoiceData['lines'][] = [
+                    'student_name' => $student->full_name(true),
+                    'audition' => $entry->audition->name,
+                    'entry_timestamp' => $entry->created_at,
+                    'entry_fee' => $entryFee,
+                    'late_fee' => $lateFee,
+                ];
+                $invoiceData['linesTotal'] += $entryFee;
+                $invoiceData['lateFeesTotal'] += $lateFee;
+            }
+        }
+        // School Fee Total
+        if (! auditionSetting('school_fee')) {
+            $invoiceData['schoolFeeTotal'] = 0;
+        } else {
+            $invoiceData['schoolFeeTotal'] = auditionSetting('school_fee') / 100;
+        }
+
+        $invoiceData['grandTotal'] = $invoiceData['linesTotal'] + $invoiceData['lateFeesTotal'] + $invoiceData['schoolFeeTotal'];
+        $schoolInvoiceData[$school->id] = $invoiceData;
+
+        return $invoiceData;
+    }
+
+    public function getLines($schoolId)
+    {
+        return $this->allData($schoolId)['lines'];
+    }
+
+    public function getLinesTotal($schoolId)
+    {
+        return $this->allData($schoolId)['linesTotal'];
+    }
+
+    public function getLateFeesTotal($schoolId)
+    {
+        return $this->allData($schoolId)['lateFeesTotal'];
+    }
+
+    public function getSchoolFeeTotal($schoolId)
+    {
+        return $this->allData($schoolId)['schoolFeeTotal'];
+
+    }
+
+    public function getGrandTotal($schoolId)
+    {
+        return $this->allData($schoolId)['grandTotal'];
+    }
+}

app/Services/Invoice/InvoiceOneFeePerStudent.php

@@ -0,0 +1,100 @@
+<?php
+
+namespace App\Services\Invoice;
+
+use App\Models\School;
+use App\Services\EntryService;
+use Illuminate\Support\Arr;
+
+use function auditionSetting;
+
+class InvoiceOneFeePerStudent implements InvoiceDataService
+{
+    /**
+     * Create a new class instance.
+     */
+    protected $entryService;
+
+    public function __construct(EntryService $entryService)
+    {
+        $this->entryService = $entryService;
+    }
+
+    public function allData($schoolId)
+    {
+        static $schoolInvoiceData = [];
+
+        if (Arr::has($schoolInvoiceData, $schoolId)) {
+            return $schoolInvoiceData[$schoolId];
+        }
+        $school = School::findOrFail($schoolId);
+
+        $invoiceData['lines'] = [];
+        $invoiceData['linesTotal'] = 0;
+        $invoiceData['lateFeesTotal'] = 0;
+        /** @noinspection PhpArrayIndexImmediatelyRewrittenInspection */
+        $invoiceData['grandTotal'] = 0;
+
+        $entries = $school->entries()->with('audition')->orderBy('created_at', 'desc')->get()->groupBy('student_id');
+        foreach ($school->students as $student) {
+            $firstEntryForStudent = true;
+            foreach ($entries[$student->id] ?? [] as $entry) {
+                if ($firstEntryForStudent) {
+                    $entryFee = $entry->audition->entry_fee / 100;
+                    $lateFee = $this->entryService->entryIsLate($entry) ? auditionSetting('late_fee') / 100 : 0;
+                } else {
+                    $entryFee = 0;
+                    $lateFee = 0;
+                }
+
+                $invoiceData['lines'][] = [
+                    'student_name' => $student->full_name(true),
+                    'audition' => $entry->audition->name,
+                    'entry_timestamp' => $entry->created_at,
+                    'entry_fee' => $entryFee,
+                    'late_fee' => $lateFee,
+                ];
+                $invoiceData['linesTotal'] += $entryFee;
+                $invoiceData['lateFeesTotal'] += $lateFee;
+                $firstEntryForStudent = false;
+            }
+        }
+        // School Fee Total
+        if (! auditionSetting('school_fee')) {
+            $invoiceData['schoolFeeTotal'] = 0;
+        } else {
+            $invoiceData['schoolFeeTotal'] = auditionSetting('school_fee') / 100;
+        }
+
+        $invoiceData['grandTotal'] = $invoiceData['linesTotal'] + $invoiceData['lateFeesTotal'] + $invoiceData['schoolFeeTotal'];
+        $schoolInvoiceData[$school->id] = $invoiceData;
+
+        return $invoiceData;
+    }
+
+    public function getLines($schoolId)
+    {
+        return $this->allData($schoolId)['lines'];
+    }
+
+    public function getLinesTotal($schoolId)
+    {
+        return $this->allData($schoolId)['linesTotal'];
+    }
+
+    public function getLateFeesTotal($schoolId)
+    {
+        return $this->allData($schoolId)['lateFeesTotal'];
+    }
+
+    public function getSchoolFeeTotal($schoolId)
+    {
+        return $this->allData($schoolId)['schoolFeeTotal'];
+
+    }
+
+    public function getGrandTotal($schoolId)
+    {
+        return $this->allData($schoolId)['grandTotal'];
+    }
+}

app/Services/ScoreService.php

@@ -20,7 +20,7 @@ class ScoreService
     /**
      * Create a new class instance.
      */
-    public function __construct(AuditionCacheService $auditionCache, EntryCacheService $entryCache)
+    public function __construct(AuditionService $auditionCache, EntryService $entryCache)
     {
         $this->auditionCache = $auditionCache;
         $this->entryCache = $entryCache;

app/Services/TabulationService.php

@@ -9,9 +9,9 @@ use Illuminate\Support\Facades\Session;
 
 class TabulationService
 {
-    protected AuditionCacheService $auditionCacheService;
+    protected AuditionService $auditionService;
 
-    protected EntryCacheService $entryCacheService;
+    protected EntryService $entryService;
 
     protected ScoreService $scoreService;
 
@@ -19,13 +19,13 @@ class TabulationService
      * Create a new class instance.
      */
     public function __construct(
-        AuditionCacheService $scoringGuideCacheService,
+        AuditionService $auditionService,
         ScoreService $scoreService,
-        EntryCacheService $entryCacheService)
+        EntryService $entryService)
     {
-        $this->auditionCacheService = $scoringGuideCacheService;
+        $this->auditionService = $auditionService;
         $this->scoreService = $scoreService;
-        $this->entryCacheService = $entryCacheService;
+        $this->entryService = $entryService;
     }
 
     /**
@@ -51,8 +51,8 @@ class TabulationService
             return $cache[$auditionId];
         }
 
-        $audition = $this->auditionCacheService->getAudition($auditionId);
+        $audition = $this->auditionService->getAudition($auditionId);
-        $entries = $this->entryCacheService->getEntriesForAudition($auditionId, $mode);
+        $entries = $this->entryService->getEntriesForAudition($auditionId, $mode);
         $this->scoreService->calculateScoresForAudition($auditionId);
         // TODO will need to pass a mode to the above function to only use subscores for hte appropriate mode
         foreach ($entries as $entry) {
@@ -91,7 +91,7 @@ class TabulationService
     public function entryScoreSheetsAreValid(Entry $entry): bool
     {
         //TODO consider making this move the invalid score to another database for further investigation
-        $validJudges = $this->auditionCacheService->getAudition($entry->audition_id)->judges;
+        $validJudges = $this->auditionService->getAudition($entry->audition_id)->judges;
         foreach ($entry->scoreSheets as $sheet) {
             if (! $validJudges->contains($sheet->user_id)) {
                 $invalidJudge = User::find($sheet->user_id);
@@ -135,11 +135,11 @@ class TabulationService
         return Cache::remember('auditionsWithStatus', 30, function () use ($mode) {
 
             // Retrieve auditions from the cache and load entry IDs
-            $auditions = $this->auditionCacheService->getAuditions($mode);
+            $auditions = $this->auditionService->getAuditions($mode);
             // Iterate over the auditions and calculate the scored_entries_count
             foreach ($auditions as $audition) {
                 $scored_entries_count = 0;
-                $entries_to_check = $this->entryCacheService->getEntriesForAudition($audition->id);
+                $entries_to_check = $this->entryService->getEntriesForAudition($audition->id);
 
                 switch ($mode) {
                     case 'seating':

bootstrap/providers.php

@@ -3,4 +3,5 @@
 return [
     App\Providers\AppServiceProvider::class,
     App\Providers\FortifyServiceProvider::class,
+    App\Providers\InvoiceDataServiceProvider::class,
 ];

resources/views/admin/audition-settings.blade.php

@@ -24,7 +24,6 @@
 
             <x-layout.page-section>
                 <x-slot:section_name>Scoring Settings</x-slot:section_name>
-                <x-slot:section_description>If students cannot advance to further honor groups, leave next event name blank</x-slot:section_description>
                 <x-form.body-grid columns="12" class="m-3">
                     <div class="col-span-6 flex space-x-3">
                         <x-form.toggle-checkbox name="judging_enabled"/><span>Enable score entry by judges</span>
@@ -37,17 +36,27 @@
 
             <x-layout.page-section>
                 <x-slot:section_name>Financial Settings</x-slot:section_name>
-                <x-slot:section_description>If students cannot advance to further honor groups, leave next event name blank</x-slot:section_description>
                 <x-form.body-grid columns="12" class="m-3">
 
                     <x-form.select name="fee_structure" colspan="6">
                         <x-slot:label>Fee Structure</x-slot:label>
-                        <option>One fee per entry</option>
+                        {{-- Values should be one of the options in the boot method InvoiceDataServiceProvider --}}
-                        <option>One fee per student</option>
+                        <option value="oneFeePerEntry" {{ auditionSetting('fee_structure') === 'oneFeePerEntry' ? 'selected':'' }}>
+                            One fee per entry
+                        </option>
+                        <option value="oneFeePerStudent" {{ auditionSetting('fee_structure') === 'oneFeePerStudent' ? 'selected':'' }}>
+                            One fee per student - one late fee per student if any of their entries are late
+                        </option>
                     </x-form.select>
 
-                    <x-form.field label_text="Late Fee" name="late_fee" colspan="3" :value="auditionSetting('late_fee')"/>
+                    <x-form.field label_text="Late Fee"
-                    <x-form.field label_text="School Membership Fee" name="school_fee" colspan="3" :value="auditionSetting('school_fee')"/>
+                                  name="late_fee"
+                                  colspan="3"
+                                  :value="number_format(auditionSetting('late_fee') / 100,2) "/>
+                    <x-form.field label_text="School Membership Fee"
+                                  name="school_fee"
+                                  colspan="3"
+                                  :value="number_format(auditionSetting('school_fee') / 100,2)"/>
 
                 </x-form.body-grid>
             </x-layout.page-section>

resources/views/admin/schools/index.blade.php

@@ -4,7 +4,7 @@
     <x-card.card>
         <x-table.table with_title_area>
             <x-slot:title class="ml-3">Schools</x-slot:title>
-            <x-slot:subtitle class="ml-3">Click school name to edit</x-slot:subtitle>
+            <x-slot:subtitle class="ml-3">Click school name to edit<br>Click total fees for invoice</x-slot:subtitle>
             <x-slot:title_block_right class="mr-3">
                 <x-form.button href="{{ route('admin.schools.create') }}">New School</x-form.button>
             </x-slot:title_block_right>
@@ -12,6 +12,7 @@
             <thead>
             <tr>
                 <x-table.th>Name</x-table.th>
+                <x-table.th>Total Fees</x-table.th>
                 <x-table.th>Directors</x-table.th>
                 <x-table.th>Students</x-table.th>
                 <x-table.th>Entries</x-table.th>
@@ -22,6 +23,11 @@
                 @foreach($schools as $school)
                     <tr>
                         <x-table.td><a href="/admin/schools/{{ $school->id }}">{{ $school->name }}</a></x-table.td>
+                        <x-table.td>
+                            <a href="{{ route('admin.schools.invoice',$school->id) }}">
+                                ${{ number_format($schoolTotalFees[$school->id],2) }}
+                            </a>
+                        </x-table.td>
                         <x-table.td>{{ $school->users->count() }}</x-table.td>
                         <x-table.td>{{ $school->students->count() }}</x-table.td>
                         <x-table.td>{{ $school->entries->count() }}</x-table.td>

resources/views/components/card/list/row.blade.php

@@ -1,5 +1,5 @@
 @props(['right_link_button_type' => 'a']) {{-- Use if the link to the right needs to be a button --}}
-<li {{ $attributes->merge(['class'=>'flex items-center justify-between gap-x-6 px-4 py-5 sm:px-6']) }}>
+<li {{ $attributes->merge(['class'=>'flex items-center justify-between gap-x-6 px-4 py-4 sm:px-6']) }}>
     <div class="flex min-w-0 gap-x-4">
         {{ $slot }}
     </div>

resources/views/dashboard/dashboard.blade.php

@@ -4,4 +4,31 @@
     @if(! Auth::user()->school_id)
         You aren't currently associated with a school. <a href="/my_school" class="text-blue-600">Click here to choose or create one.</a>
     @endif
+    <div class="grid sm:grid-cols-2 md:grid-cols-4">
+        <div>{{-- Column 1 --}}
+            <x-card.card>
+                <x-card.heading>User Options</x-card.heading>
+                <x-card.list.body>
+                    <a href="{{ route('my_profile') }}">
+                        <x-card.list.row class="hover:bg-gray-200">
+                            My Profile
+                        </x-card.list.row>
+                    </a>
+                    <a href="{{ route('my_school') }}">
+                        <x-card.list.row class="hover:bg-gray-200">
+                            My School
+                        </x-card.list.row>
+                    </a>
+                    @if(Auth::user()->school_id)
+                        <a href="{{ route('my_invoice') }}">
+                            <x-card.list.row class="hover:bg-gray-200">
+                                My Invoice
+                            </x-card.list.row>
+                        </a>
+                    @endif
+                </x-card.list.body>
+            </x-card.card>
+        </div>
+
+    </div>
 </x-layout.app>

resources/views/dashboard/invoice.blade.php

@@ -0,0 +1,50 @@
+@props(['school', 'invoiceData'])
+
+<x-layout.app>
+    <x-slot:page_title>Invoice - {{ $school->name }}</x-slot:page_title>
+    <div class="">
+        <x-table.table class="">
+            <thead class="">
+            <tr>
+                <x-table.th>Student Name</x-table.th>
+                <x-table.th>Audition</x-table.th>
+                <x-table.th>Entry Timestamp</x-table.th>
+                <x-table.th>Entry Fee</x-table.th>
+                <x-table.th>Late Fee</x-table.th>
+            </tr>
+            </thead>
+            <x-table.body>
+                @foreach($invoiceData['lines'] as $line)
+                    <tr>
+                        <x-table.td>{{ $line['student_name'] }}</x-table.td>
+                        <x-table.td>{{ $line['audition'] }}</x-table.td>
+                        <x-table.td>{{ $line['entry_timestamp']->setTimezone('America/Chicago')->format('m/d/Y g:i:s A') }}</x-table.td>
+                        <x-table.td>${{ number_format($line['entry_fee'],2) }}</x-table.td>
+                        <x-table.td>${{ number_format($line['late_fee'],2) }}</x-table.td>
+                    </tr>
+                @endforeach
+            </x-table.body>
+            <tfoot class="">
+                <tr>
+                    <td colspan="2">
+                    <x-table.th class="text-right">Totals</x-table.th>
+                    <x-table.th>${{ number_format($invoiceData['linesTotal'],2) }}</x-table.th>
+                    <x-table.th>${{ number_format($invoiceData['lateFeesTotal'],2) }}</x-table.th>
+                </tr>
+                <tr>
+                    <td colspan="3"></td>
+                    <x-table.th class="text-right">Total Entry Fees</x-table.th>
+                    <x-table.th>${{ number_format($invoiceData['linesTotal'] + $invoiceData['lateFeesTotal'], 2) }}</x-table.th>
+                </tr>
+                <tr>
+                    <x-table.th colspan="4" class="text-right">School Fee</x-table.th>
+                    <x-table.th >${{ number_format($invoiceData['schoolFeeTotal'],2) }}</x-table.th>
+                </tr>
+                <tr>
+                    <x-table.th colspan="4" class="text-right">Grand Total</x-table.th>
+                    <x-table.th >${{ number_format($invoiceData['grandTotal'],2) }}</x-table.th>
+                </tr>
+            </tfoot>
+        </x-table.table>
+    </div>
+</x-layout.app>

resources/views/dashboard/profile.blade.php

@@ -18,59 +18,3 @@
         </x-layout.page-section>
     </x-layout.page-section-container>
 </x-layout.app>
-
-
-
-{{--@php use Illuminate\Support\Facades\Auth; @endphp
-<x-layout.app>
-    <x-slot:page_title>User Profile</x-slot:page_title>
-    <div class="space-y-10 divide-y divide-gray-900/10">
-        <x-layout.page-section
-            section_name="Personal Information"
-            section_description="Use a permanent address where you receive mail"
-        >
-            @if (session('status') === 'profile-information-updated')
-                <div class="mt-4 px-8 font-medium text-sm text-green-600">
-                    Profile Info has been updated.
-                </div>
-            @endif
-
-            <form action="/user/profile-information" method="POST">
-                @csrf
-                @method('PUT')
-                <div class="px-4 py-6 sm:p-8">
-                    <div class="grid max-w-2xl grid-cols-1 gap-x-6 gap-y-8 sm:grid-cols-6">
-                        <x-form.field name="first_name" label="First Name" value="{{ Auth::user()->first_name }}" div_classes="sm:col-span-3" />
-                        <x-form.field name="last_name" label="Last Name" value="{{ Auth::user()->last_name }}" div_classes="sm:col-span-3" />
-                        <x-form.field name="email" label="Email Address" value="{{ Auth::user()->email }}" div_classes="sm:col-span-3" />
-                        <x-form.field name="cell_phone" label="Cell Phone" value="{{ Auth::user()->cell_phone }}" div_classes="sm:col-span-3" />
-                        <x-form.field name="judging_preference" label="Judging Preference" value="{{ Auth::user()->judging_preference }}" div_classes="sm:col-span-5" />
-                    </div>
-                </div>
-                <div class="flex items-center justify-end gap-x-6 border-t border-gray-900/10 px-4 py-4 sm:px-8">
-                    <x-form.button-nocolor type="button">Cancel</x-form.button-nocolor>
-                    <x-form.button>Update Profile</x-form.button>
-                </div>
-            </form>
-
-        </x-layout.page-section>
-
-        <x-layout.page-section
-            section_name="Change Password"
-            section_description="Update your user password"
-        >
-            @if (session('status') === 'password-updated')
-                <div class="mt-4 px-8 font-medium text-sm text-green-600">
-                   Password has been updated.
-                </div>
-            @endif
-
-            <x-form.card method="PUT" action="/user/password" cols="1" submit-button-text="Change Password">
-                <x-form.field name="current_password" label="Current Password" type="password" autocomplete="current-password" required />
-                <x-form.field name="password" label="New Password" type="password" autocomplete="new-password" required />
-                <x-form.field name="password_confirmation" label="Confirm New Password" autocomplete="new-password" type="password" required />
-            </x-form.card>
-
-        </x-layout.page-section>
-    </div>
-</x-layout.app>--}}

resources/views/test.blade.php

@@ -10,18 +10,16 @@
  use Illuminate\Support\Facades\Session;
 @endphp
 @inject('scoreservice','App\Services\ScoreService');
-@inject('auditionService','App\Services\AuditionCacheService');
+@inject('auditionService','App\Services\AuditionService');
-@inject('entryService','App\Services\EntryCacheService')
+@inject('entryService','App\Services\EntryService')
 @inject('seatingService','App\Services\SeatingService')
 <x-layout.app>
     <x-slot:page_title>Test Page</x-slot:page_title>
     @php
-        $schools = School::all();
+        dump($totalFees);
+        dump($lines);
 
-        }
     @endphp
 
 
-
-
 </x-layout.app>

routes/admin.php

@@ -99,6 +99,7 @@ Route::middleware(['auth', 'verified', CheckIfAdmin::class])->prefix('admin/')->
         Route::get('/create', 'create')->name('admin.schools.create');
         Route::get('/{school}', 'show')->name('admin.schools.show');
         Route::get('/{school}/edit', 'edit')->name('admin.schools.edit');
+        Route::get('/{school}/invoice', 'viewInvoice')->name('admin.schools.invoice');
         Route::patch('/{school}', 'update')->name('admin.schools.update');
         Route::post('/', 'store')->name('admin.schools.store');
         Route::delete('/domain/{domain}', 'destroy_domain')->name('admin.schools.destroy_domain');

routes/user.php

@@ -10,8 +10,9 @@ use Illuminate\Support\Facades\Route;
 
 Route::middleware(['auth', 'verified'])->group(function () {
     Route::get('/dashboard', [DashboardController::class, 'dashboard'])->name('dashboard');
-    Route::get('/profile', [DashboardController::class, 'profile']);
+    Route::get('/profile', [DashboardController::class, 'profile'])->name('my_profile');
-    Route::get('/my_school', [DashboardController::class, 'my_school']);
+    Route::get('/my_school', [DashboardController::class, 'my_school'])->name('my_school');
+    Route::get('/my_invoice', [DashboardController::class, 'my_invoice'])->name('my_invoice');
 });
 
 // Entry Related Routes